C13H22N2O3 — CID 178119540
tert-butyl N-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]methyl]carbamate (PubChem CID 178119540) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 178119540 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl N-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]methyl]carbamate |
| SMILES | C=CC(=O)N1CC[C@H](CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-5-11(16)15-7-6-10(9-15)8-14-12(17)18-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,14,17)/t10-/m1/s1 |
| InChIKey | VDZLRWSNSBYQKM-SNVBAGLBSA-N |
| XLogP | 1.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|