C22H36N2O3 — CID 58254849
tert-butyl N-[[(3S)-1-[2-(2-adamantyl)acetyl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 58254849) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl N-[[(3S)-1-[2-(2-adamantyl)acetyl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3S)-1-[2-(2-adamantyl)acetyl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58254849 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | tert-butyl N-[[(3S)-1-[2-(2-adamantyl)acetyl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCN(C(=O)CC2C3CC4CC(C3)CC2C4)C1 |
| InChI | InChI=1S/C22H36N2O3/c1-22(2,3)27-21(26)23-12-14-4-5-24(13-14)20(25)11-19-17-7-15-6-16(9-17)10-18(19)8-15/h14-19H,4-13H2,1-3H3,(H,23,26)/t14-,15?,16?,17?,18?,19?/m0/s1 |
| InChIKey | GAXDJGZCQZTLKU-QWEMWOLJSA-N |
| XLogP | 3.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |