C11H19N4O4S+ — CID 168727150
tert-butyl 3-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,3-diazetidine-1-carboxylate (PubChem CID 168727150) has the molecular formula C11H19N4O4S+ and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl 3-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,3-diazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,3-diazetidine-1-carboxylate |
|---|---|
| PubChem CID | 168727150 |
| Molecular Formula | C11H19N4O4S+ |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | tert-butyl 3-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,3-diazetidine-1-carboxylate |
| SMILES | C[n+]1ccn(S(=O)(=O)N2CN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C11H19N4O4S/c1-11(2,3)19-10(16)13-8-15(9-13)20(17,18)14-6-5-12(4)7-14/h5-7H,8-9H2,1-4H3/q+1 |
| InChIKey | YWZKOGGEJGDDNT-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 75.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|