C28H36F3N5O8S2 — CID 86641500
tert-butyl 5-(3-methylimidazol-3-ium-1-yl)sulfonyl-8-(4-methylpiperidine-1-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate;trifluoromethanesulfonate (PubChem CID 86641500) has the molecular formula C28H36F3N5O8S2 and a molecular weight of 691.75 g/mol. Its IUPAC name is tert-butyl 5-(3-methylimidazol-3-ium-1-yl)sulfonyl-8-(4-methylpiperidine-1-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate;trifluoromethanesulfonate.
| Compound Name | tert-butyl 5-(3-methylimidazol-3-ium-1-yl)sulfonyl-8-(4-methylpiperidine-1-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86641500 |
| Molecular Formula | C28H36F3N5O8S2 |
| Molecular Weight | 691.75 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | tert-butyl 5-(3-methylimidazol-3-ium-1-yl)sulfonyl-8-(4-methylpiperidine-1-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate;trifluoromethanesulfonate |
| SMILES | CC1CCN(C(=O)c2ccc3c(c2)c2c(n3S(=O)(=O)n3cc[n+](C)c3)CCN(C(=O)OC(C)(C)C)C2)CC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C27H36N5O5S.CHF3O3S/c1-19-8-11-29(12-9-19)25(33)20-6-7-23-21(16-20)22-17-30(26(34)37-27(2,3)4)13-10-24(22)32(23)38(35,36)31-15-14-28(5)18-31;2-1(3,4)8(5,6)7/h6-7,14-16,18-19H,8-13,17H2,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | LBCYWVFHYAURKK-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 154.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.75 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|