C17H27IN4O3 — CID 154652497
tert-butyl 7-(3-methylimidazol-3-ium-1-carbonyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate iodide (PubChem CID 154652497) has the molecular formula C17H27IN4O3 and a molecular weight of 462.33 g/mol. Its IUPAC name is tert-butyl 7-(3-methylimidazol-3-ium-1-carbonyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate iodide.
| Compound Name | tert-butyl 7-(3-methylimidazol-3-ium-1-carbonyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate iodide |
|---|---|
| PubChem CID | 154652497 |
| Molecular Formula | C17H27IN4O3 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | tert-butyl 7-(3-methylimidazol-3-ium-1-carbonyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate iodide |
| SMILES | C[n+]1ccn(C(=O)N2CCC3(CC2)CN(C(=O)OC(C)(C)C)C3)c1.[I-] |
| InChI | InChI=1S/C17H27N4O3.HI/c1-16(2,3)24-15(23)21-11-17(12-21)5-7-19(8-6-17)14(22)20-10-9-18(4)13-20;/h9-10,13H,5-8,11-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ORCSMFWCZJHSJX-UHFFFAOYSA-M |
| XLogP | -1.38 |
| TPSA | 58.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|