C15H18ClF3N3O5S2+ — CID 175094762
6-chloro-2-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline;trifluoromethanesulfonic acid (PubChem CID 175094762) has the molecular formula C15H18ClF3N3O5S2+ and a molecular weight of 476.91 g/mol. Its IUPAC name is 6-chloro-2-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline;trifluoromethanesulfonic acid.
| Compound Name | 6-chloro-2-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175094762 |
| Molecular Formula | C15H18ClF3N3O5S2+ |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 6-chloro-2-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline;trifluoromethanesulfonic acid |
| SMILES | Cc1n(S(=O)(=O)N2CCc3cc(Cl)ccc3C2)cc[n+]1C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C14H17ClN3O2S.CHF3O3S/c1-11-16(2)7-8-18(11)21(19,20)17-6-5-12-9-14(15)4-3-13(12)10-17;2-1(3,4)8(5,6)7/h3-4,7-9H,5-6,10H2,1-2H3;(H,5,6,7)/q+1; |
| InChIKey | PQWIBSQGRJLQKT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|