C13H18FNO2S — CID 154880759
6-tert-butyl-3,4-dihydro-1H-isoquinoline-2-sulfonyl fluoride (PubChem CID 154880759) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-tert-butyl-3,4-dihydro-1H-isoquinoline-2-sulfonyl fluoride.
| Compound Name | 6-tert-butyl-3,4-dihydro-1H-isoquinoline-2-sulfonyl fluoride |
|---|---|
| PubChem CID | 154880759 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 6-tert-butyl-3,4-dihydro-1H-isoquinoline-2-sulfonyl fluoride |
| SMILES | CC(C)(C)c1ccc2c(c1)CCN(S(=O)(=O)F)C2 |
| InChI | InChI=1S/C13H18FNO2S/c1-13(2,3)12-5-4-11-9-15(18(14,16)17)7-6-10(11)8-12/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | BUHDRZDHAFZAMH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |