C20H17NO4S — CID 154697560
1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)anthracene-9,10-dione (PubChem CID 154697560) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)anthracene-9,10-dione.
| Compound Name | 1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 154697560 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)anthracene-9,10-dione |
| SMILES | CS(=O)(=O)N1CC=C(c2cccc3c2C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C20H17NO4S/c1-26(24,25)21-11-9-13(10-12-21)14-7-4-8-17-18(14)20(23)16-6-3-2-5-15(16)19(17)22/h2-9H,10-12H2,1H3 |
| InChIKey | RJBSWSSFZWYDGW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|