About 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid
1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid (PubChem CID 152661850) has the molecular formula C7H11NO4S
and a molecular weight of 205.23 g/mol. Its IUPAC name is 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid.
Analyze 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
The IUPAC name of 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid (CID 152661850) is 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid.
What is the SMILES notation for 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
The canonical SMILES for 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid is CS(=O)(=O)N1CC=C(C(=O)O)CC1.
What is the InChIKey of 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
The InChIKey is ZJSHJSFQBXYSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4S/c1-13(11,12)8-4-2-6(3-5-8)7(9)10/h2H,3-5H2,1H3,(H,9,10).
What are the key properties of 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid?
1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid has a molecular weight of 205.23 g/mol, XLogP of -0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-3,6-dihydro-2H-pyridine-4-carboxylic acid is sourced from PubChem (CID 152661850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).