C10H15NO5 — CID 11983341
1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanone;oxalic acid (PubChem CID 11983341) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanone;oxalic acid.
| Compound Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanone;oxalic acid |
|---|---|
| PubChem CID | 11983341 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanone;oxalic acid |
| SMILES | CC(=O)C1=CCN(C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H13NO.C2H2O4/c1-7(10)8-3-5-9(2)6-4-8;3-1(4)2(5)6/h3H,4-6H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | NYCGUZMTWNYRFG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|