C13H21NO5 — CID 67880214
2-methyl-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butan-1-one;oxalic acid (PubChem CID 67880214) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-methyl-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butan-1-one;oxalic acid.
| Compound Name | 2-methyl-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butan-1-one;oxalic acid |
|---|---|
| PubChem CID | 67880214 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-methyl-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butan-1-one;oxalic acid |
| SMILES | CCC(C)C(=O)C1=CCN(C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H19NO.C2H2O4/c1-4-9(2)11(13)10-5-7-12(3)8-6-10;3-1(4)2(5)6/h5,9H,4,6-8H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SAFIRRSPMUILOV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|