C14H15BrN2O2S — CID 84569970
5-bromo-3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole (PubChem CID 84569970) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is 5-bromo-3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole.
| Compound Name | 5-bromo-3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 84569970 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 5-bromo-3-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
| SMILES | CS(=O)(=O)N1CC=C(c2c[nH]c3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C14H15BrN2O2S/c1-20(18,19)17-6-4-10(5-7-17)13-9-16-14-3-2-11(15)8-12(13)14/h2-4,8-9,16H,5-7H2,1H3 |
| InChIKey | HOQHTFWGIXFSRH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |