C20H17BrN2O2 — CID 84558654
(E)-1-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 84558654) has the molecular formula C20H17BrN2O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is (E)-1-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 84558654 |
| Molecular Formula | C20H17BrN2O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (E)-1-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)N1CC=C(c2c[nH]c3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C20H17BrN2O2/c21-15-3-5-19-17(12-15)18(13-22-19)14-7-9-23(10-8-14)20(24)6-4-16-2-1-11-25-16/h1-7,11-13,22H,8-10H2/b6-4+ |
| InChIKey | UESKHRNXNUOHQF-GQCTYLIASA-N |
| XLogP | 4.85 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|