C23H19BrClN3O3 — CID 75796345
2-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-6-chloro-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 75796345) has the molecular formula C23H19BrClN3O3 and a molecular weight of 500.78 g/mol. Its IUPAC name is 2-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-6-chloro-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-6-chloro-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75796345 |
| Molecular Formula | C23H19BrClN3O3 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 2-[4-(5-bromo-1H-indol-3-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]-6-chloro-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C(=O)N2CC=C(c3c[nH]c4ccc(Br)cc34)CC2)Oc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C23H19BrClN3O3/c1-23(21(29)27-19-11-15(25)3-5-20(19)31-23)22(30)28-8-6-13(7-9-28)17-12-26-18-4-2-14(24)10-16(17)18/h2-6,10-12,26H,7-9H2,1H3,(H,27,29) |
| InChIKey | ZCBGLTNBAIBXEE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|