C19H29NO6S — CID 156678841
tert-butyl (4R,5R)-2,2,5-trimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 156678841) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is tert-butyl (4R,5R)-2,2,5-trimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5R)-2,2,5-trimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 156678841 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | tert-butyl (4R,5R)-2,2,5-trimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2[C@@H](C)OC(C)(C)N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO6S/c1-13-8-10-15(11-9-13)27(22,23)24-12-16-14(2)25-19(6,7)20(16)17(21)26-18(3,4)5/h8-11,14,16H,12H2,1-7H3/t14-,16-/m1/s1 |
| InChIKey | ZOSCUAOOVAOYGM-GDBMZVCRSA-N |
| XLogP | 3.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|