C18H26O7 — CID 90801317
[(2R,3R,4S,5R,6S)-3,5,6-trihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 90801317) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5,6-trihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5,6-trihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90801317 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5,6-trihydroxy-4-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C18H26O7/c1-18(2,3)17(22)24-10-12-13(19)15(14(20)16(21)25-12)23-9-11-7-5-4-6-8-11/h4-8,12-16,19-21H,9-10H2,1-3H3/t12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | NNQQJJDYNYUQMX-SUJAAXHWSA-N |
| XLogP | 0.60 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |