C21H22O2 — CID 101412430
(4S,5S)-3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one (PubChem CID 101412430) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (4S,5S)-3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one.
| Compound Name | (4S,5S)-3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one |
|---|---|
| PubChem CID | 101412430 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (4S,5S)-3-methylidene-4,5-bis(2-phenylethyl)oxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](CCc2ccccc2)[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C21H22O2/c1-16-19(14-12-17-8-4-2-5-9-17)20(23-21(16)22)15-13-18-10-6-3-7-11-18/h2-11,19-20H,1,12-15H2/t19-,20-/m0/s1 |
| InChIKey | RJPJTORCLPJVCS-PMACEKPBSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|