C19H26N2O — CID 10040355
(5S)-5-hexyl-3-[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]-4,5-dihydro-1,2-oxazole (PubChem CID 10040355) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (5S)-5-hexyl-3-[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]-4,5-dihydro-1,2-oxazole.
| Compound Name | (5S)-5-hexyl-3-[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10040355 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (5S)-5-hexyl-3-[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]-4,5-dihydro-1,2-oxazole |
| SMILES | CCCCCC[C@H]1CC([C@@H]2CCC(c3ccccc3)=N2)=NO1 |
| InChI | InChI=1S/C19H26N2O/c1-2-3-4-8-11-16-14-19(21-22-16)18-13-12-17(20-18)15-9-6-5-7-10-15/h5-7,9-10,16,18H,2-4,8,11-14H2,1H3/t16-,18-/m0/s1 |
| InChIKey | JLYBJQZNOJNMPZ-WMZOPIPTSA-N |
| XLogP | 4.75 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|