C34H49NO5 — CID 25231962
[3-(4-heptoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-decoxybenzoate (PubChem CID 25231962) has the molecular formula C34H49NO5 and a molecular weight of 551.77 g/mol. Its IUPAC name is [3-(4-heptoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-decoxybenzoate.
| Compound Name | [3-(4-heptoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-decoxybenzoate |
|---|---|
| PubChem CID | 25231962 |
| Molecular Formula | C34H49NO5 |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.36 |
| IUPAC Name | [3-(4-heptoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)OCC2CC(c3ccc(OCCCCCCC)cc3)=NO2)cc1 |
| InChI | InChI=1S/C34H49NO5/c1-3-5-7-9-10-11-13-15-25-38-31-22-18-29(19-23-31)34(36)39-27-32-26-33(35-40-32)28-16-20-30(21-17-28)37-24-14-12-8-6-4-2/h16-23,32H,3-15,24-27H2,1-2H3 |
| InChIKey | UAPXPDJGYDNYJG-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|