C12H10N2O3 — CID 102725072
3-(4-cyanophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 102725072) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(4-cyanophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 102725072 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-(4-cyanophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | CC1(C(=O)O)CC(c2ccc(C#N)cc2)=NO1 |
| InChI | InChI=1S/C12H10N2O3/c1-12(11(15)16)6-10(14-17-12)9-4-2-8(7-13)3-5-9/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | RAZIPZGULHZWSG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |