3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid

C11H9F2NO3 — CID 103693713

IUPAC3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid
SMILESCC1(C(=O)O)CC(c2ccc(F)c(F)c2)=NO1
InChIInChI=1S/C11H9F2NO3/c1-11(10(15)16)5-9(14-17-11)6-2-3-7(12)8(13)4-6/h2-4H,5H2,1H3,(H,15,16)
InChIKeyUYBFIJPYPLYSPN-UHFFFAOYSA-N
MW241.19 g/mol
LogP1.93
Rot. Bonds2

About 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid

3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 103693713) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid
PubChem CID103693713
Molecular FormulaC11H9F2NO3
Molecular Weight241.19 g/mol
Exact Mass241.06
IUPAC Name3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid
SMILESCC1(C(=O)O)CC(c2ccc(F)c(F)c2)=NO1
InChIInChI=1S/C11H9F2NO3/c1-11(10(15)16)5-9(14-17-11)6-2-3-7(12)8(13)4-6/h2-4H,5H2,1H3,(H,15,16)
InChIKeyUYBFIJPYPLYSPN-UHFFFAOYSA-N
XLogP1.93
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.19
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (CID 103693713) is 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid is CC1(C(=O)O)CC(c2ccc(F)c(F)c2)=NO1.
What is the InChIKey of 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is UYBFIJPYPLYSPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO3/c1-11(10(15)16)5-9(14-17-11)6-2-3-7(12)8(13)4-6/h2-4H,5H2,1H3,(H,15,16).
What are the key properties of 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 241.19 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 103693713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).