C38H41O8+ — CID 134887768
[ethoxy-[3,14,14-tris(ethoxycarbonyl)-3-pentacyclo[14.6.2.25,12.06,11.017,22]hexacosa-1(23),5(26),6,8,10,12(25),16(24),17,19,21-decaenyl]methylidene]oxidanium (PubChem CID 134887768) has the molecular formula C38H41O8+ and a molecular weight of 625.74 g/mol. Its IUPAC name is [ethoxy-[3,14,14-tris(ethoxycarbonyl)-3-pentacyclo[14.6.2.25,12.06,11.017,22]hexacosa-1(23),5(26),6,8,10,12(25),16(24),17,19,21-decaenyl]methylidene]oxidanium.
| Compound Name | [ethoxy-[3,14,14-tris(ethoxycarbonyl)-3-pentacyclo[14.6.2.25,12.06,11.017,22]hexacosa-1(23),5(26),6,8,10,12(25),16(24),17,19,21-decaenyl]methylidene]oxidanium |
|---|---|
| PubChem CID | 134887768 |
| Molecular Formula | C38H41O8+ |
| Molecular Weight | 625.74 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | [ethoxy-[3,14,14-tris(ethoxycarbonyl)-3-pentacyclo[14.6.2.25,12.06,11.017,22]hexacosa-1(23),5(26),6,8,10,12(25),16(24),17,19,21-decaenyl]methylidene]oxidanium |
| SMILES | [H]/[O+]=C(\OCC)C1(C(=O)OCC)Cc2ccc(c3ccccc23)CC(C(=O)OCC)(C(=O)OCC)Cc2ccc(c3ccccc23)C1 |
| InChI | InChI=1S/C38H40O8/c1-5-43-33(39)37(34(40)44-6-2)21-25-17-19-27(31-15-11-9-13-29(25)31)23-38(35(41)45-7-3,36(42)46-8-4)24-28-20-18-26(22-37)30-14-10-12-16-32(28)30/h9-20H,5-8,21-24H2,1-4H3/p+1 |
| InChIKey | SLSJCBSPOHBOFV-UHFFFAOYSA-O |
| XLogP | 6.08 |
| TPSA | 109.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|