C22H36O6Si — CID 102121639
ethyl (1R,4S,7S,8R,11R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-6,10-dioxo-5-oxatricyclo[5.2.2.04,8]undecane-11-carboxylate (PubChem CID 102121639) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is ethyl (1R,4S,7S,8R,11R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-6,10-dioxo-5-oxatricyclo[5.2.2.04,8]undecane-11-carboxylate.
| Compound Name | ethyl (1R,4S,7S,8R,11R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-6,10-dioxo-5-oxatricyclo[5.2.2.04,8]undecane-11-carboxylate |
|---|---|
| PubChem CID | 102121639 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | ethyl (1R,4S,7S,8R,11R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,9-dimethyl-6,10-dioxo-5-oxatricyclo[5.2.2.04,8]undecane-11-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)[C@@H]2CC[C@]3(CO[Si](C)(C)C(C)(C)C)OC(=O)[C@H]1[C@@H]3C2(C)C |
| InChI | InChI=1S/C22H36O6Si/c1-9-26-18(24)14-15-17-21(5,6)13(16(14)23)10-11-22(17,28-19(15)25)12-27-29(7,8)20(2,3)4/h13-15,17H,9-12H2,1-8H3/t13-,14+,15+,17+,22+/m0/s1 |
| InChIKey | WXNQOQBOBMBAIT-IFRLTOADSA-N |
| XLogP | 3.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|