C21H34O5Si — CID 102207175
ethyl (1S,3aS,4S,5R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenyl-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 102207175) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is ethyl (1S,3aS,4S,5R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenyl-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | ethyl (1S,3aS,4S,5R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenyl-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 102207175 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | ethyl (1S,3aS,4S,5R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-ethenyl-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | C=C[C@@H]1OC(=O)[C@H]2[C@H]1C=C(C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]2C(=O)OCC |
| InChI | InChI=1S/C21H34O5Si/c1-9-16-14-11-13(3)15(12-25-27(7,8)21(4,5)6)18(19(22)24-10-2)17(14)20(23)26-16/h9,11,14-18H,1,10,12H2,2-8H3/t14-,15-,16-,17-,18-/m0/s1 |
| InChIKey | AVQRPGDGULWVLS-ATIWLJMLSA-N |
| XLogP | 4.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|