C32H64O5Si3 — CID 101392100
methyl (1R,2S,3S,3aR,4R,5S,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-1-triethylsilyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate (PubChem CID 101392100) has the molecular formula C32H64O5Si3 and a molecular weight of 613.12 g/mol. Its IUPAC name is methyl (1R,2S,3S,3aR,4R,5S,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-1-triethylsilyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (1R,2S,3S,3aR,4R,5S,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-1-triethylsilyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 101392100 |
| Molecular Formula | C32H64O5Si3 |
| Molecular Weight | 613.12 g/mol |
| Exact Mass | 612.41 |
| IUPAC Name | methyl (1R,2S,3S,3aR,4R,5S,7aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-1-triethylsilyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@@H]1C=C(C)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]2C(=O)OC |
| InChI | InChI=1S/C32H64O5Si3/c1-17-40(18-2,19-3)37-28-23(5)29(36-39(15,16)32(9,10)11)26-24(28)20-22(4)25(27(26)30(33)34-12)21-35-38(13,14)31(6,7)8/h20,23-29H,17-19,21H2,1-16H3/t23-,24-,25+,26+,27+,28-,29+/m0/s1 |
| InChIKey | RIIZPUPBUFVBCQ-RLHKHABASA-N |
| XLogP | 9.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.12 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|