C19H42O6Si2 — CID 71607179
(2R,3R,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-5-triethylsilyloxyoxane-3,4-diol (PubChem CID 71607179) has the molecular formula C19H42O6Si2 and a molecular weight of 422.71 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-5-triethylsilyloxyoxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-5-triethylsilyloxyoxane-3,4-diol |
|---|---|
| PubChem CID | 71607179 |
| Molecular Formula | C19H42O6Si2 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-5-triethylsilyloxyoxane-3,4-diol |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](OC)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H42O6Si2/c1-10-27(11-2,12-3)25-17-16(21)15(20)14(24-18(17)22-7)13-23-26(8,9)19(4,5)6/h14-18,20-21H,10-13H2,1-9H3/t14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | HRMZMTSPFCUWMM-ICUGJSFKSA-N |
| XLogP | 3.49 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|