C21H32O5Si — CID 174923210
(2S,3S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-(1-phenylprop-2-ynoxy)oxolan-3-ol (PubChem CID 174923210) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-(1-phenylprop-2-ynoxy)oxolan-3-ol.
| Compound Name | (2S,3S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-(1-phenylprop-2-ynoxy)oxolan-3-ol |
|---|---|
| PubChem CID | 174923210 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2S,3S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxy-4-(1-phenylprop-2-ynoxy)oxolan-3-ol |
| SMILES | C#CC(O[C@@H]1[C@@H](OC)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C21H32O5Si/c1-8-16(15-12-10-9-11-13-15)25-19-18(22)17(26-20(19)23-5)14-24-27(6,7)21(2,3)4/h1,9-13,16-20,22H,14H2,2-7H3/t16?,17-,18-,19-,20-/m0/s1 |
| InChIKey | FOXCBFBDFJWMFE-SAADTMEZSA-N |
| XLogP | 3.50 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|