C23H36O7Si — CID 166177102
(2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1S,2S)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-methoxyoxane-3,5-diol (PubChem CID 166177102) has the molecular formula C23H36O7Si and a molecular weight of 452.62 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1S,2S)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-methoxyoxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1S,2S)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-methoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 166177102 |
| Molecular Formula | C23H36O7Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1S,2S)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-methoxyoxane-3,5-diol |
| SMILES | CO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[C@H]2C=Cc3ccccc3[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C23H36O7Si/c1-23(2,3)31(5,6)28-13-17-19(25)21(20(26)22(27-4)30-17)29-16-12-11-14-9-7-8-10-15(14)18(16)24/h7-12,16-22,24-26H,13H2,1-6H3/t16-,17+,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | BCCMYJYCCMZQNJ-UIZIODFASA-N |
| XLogP | 2.62 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|