C21H30O3Si — CID 6612656
tert-butyl-dimethyl-[[(6S)-6-(1-phenylprop-2-ynoxy)-3,6-dihydro-2H-pyran-2-yl]methoxy]silane (PubChem CID 6612656) has the molecular formula C21H30O3Si and a molecular weight of 358.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(6S)-6-(1-phenylprop-2-ynoxy)-3,6-dihydro-2H-pyran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(6S)-6-(1-phenylprop-2-ynoxy)-3,6-dihydro-2H-pyran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 6612656 |
| Molecular Formula | C21H30O3Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | tert-butyl-dimethyl-[[(6S)-6-(1-phenylprop-2-ynoxy)-3,6-dihydro-2H-pyran-2-yl]methoxy]silane |
| SMILES | C#CC(O[C@@H]1C=CCC(CO[Si](C)(C)C(C)(C)C)O1)c1ccccc1 |
| InChI | InChI=1S/C21H30O3Si/c1-7-19(17-12-9-8-10-13-17)24-20-15-11-14-18(23-20)16-22-25(5,6)21(2,3)4/h1,8-13,15,18-20H,14,16H2,2-6H3/t18?,19?,20-/m1/s1 |
| InChIKey | MHFHYVRGAGJUBV-SOAGJPPSSA-N |
| XLogP | 5.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|