C27H56O9Si2 — CID 71502014
tert-butyl-[[(2R,3R,4R,5S)-5-[[(2S,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethoxyoxolan-2-yl]methoxy]-3,4-dimethoxyoxolan-2-yl]methoxy]-dimethylsilane (PubChem CID 71502014) has the molecular formula C27H56O9Si2 and a molecular weight of 580.91 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R,4R,5S)-5-[[(2S,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethoxyoxolan-2-yl]methoxy]-3,4-dimethoxyoxolan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3R,4R,5S)-5-[[(2S,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethoxyoxolan-2-yl]methoxy]-3,4-dimethoxyoxolan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71502014 |
| Molecular Formula | C27H56O9Si2 |
| Molecular Weight | 580.91 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | tert-butyl-[[(2R,3R,4R,5S)-5-[[(2S,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dimethoxyoxolan-2-yl]methoxy]-3,4-dimethoxyoxolan-2-yl]methoxy]-dimethylsilane |
| SMILES | CO[C@@H]1[C@H](OC)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C27H56O9Si2/c1-26(2,3)37(11,12)33-16-19-22(29-8)21(28-7)18(35-19)15-32-25-24(31-10)23(30-9)20(36-25)17-34-38(13,14)27(4,5)6/h18-25H,15-17H2,1-14H3/t18-,19-,20-,21+,22-,23-,24-,25+/m1/s1 |
| InChIKey | QJPYCXBQJHCJLP-YMSJCZCJSA-N |
| XLogP | 4.60 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|