C20H42O5Si2 — CID 102362334
2-[(2S,3R,4R,5R)-5-methoxy-4-triethylsilyloxy-2-(triethylsilyloxymethyl)oxolan-3-yl]acetaldehyde (PubChem CID 102362334) has the molecular formula C20H42O5Si2 and a molecular weight of 418.72 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-5-methoxy-4-triethylsilyloxy-2-(triethylsilyloxymethyl)oxolan-3-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,4R,5R)-5-methoxy-4-triethylsilyloxy-2-(triethylsilyloxymethyl)oxolan-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 102362334 |
| Molecular Formula | C20H42O5Si2 |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-5-methoxy-4-triethylsilyloxy-2-(triethylsilyloxymethyl)oxolan-3-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)OC[C@H]1O[C@@H](OC)[C@H](O[Si](CC)(CC)CC)[C@@H]1CC=O |
| InChI | InChI=1S/C20H42O5Si2/c1-8-26(9-2,10-3)23-16-18-17(14-15-21)19(20(22-7)24-18)25-27(11-4,12-5)13-6/h15,17-20H,8-14,16H2,1-7H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | SRWPPFWVGTYLQK-UAFMIMERSA-N |
| XLogP | 4.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|