C23H37NO6Si — CID 11270899
N-[(2S,3R,4R,5S,6R)-2-methoxy-6-(2-oxoethyl)-4-phenylmethoxy-5-triethylsilyloxyoxan-3-yl]acetamide (PubChem CID 11270899) has the molecular formula C23H37NO6Si and a molecular weight of 451.64 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-2-methoxy-6-(2-oxoethyl)-4-phenylmethoxy-5-triethylsilyloxyoxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-2-methoxy-6-(2-oxoethyl)-4-phenylmethoxy-5-triethylsilyloxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 11270899 |
| Molecular Formula | C23H37NO6Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2-methoxy-6-(2-oxoethyl)-4-phenylmethoxy-5-triethylsilyloxyoxan-3-yl]acetamide |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](OCc2ccccc2)[C@@H](NC(C)=O)[C@@H](OC)O[C@@H]1CC=O |
| InChI | InChI=1S/C23H37NO6Si/c1-6-31(7-2,8-3)30-21-19(14-15-25)29-23(27-5)20(24-17(4)26)22(21)28-16-18-12-10-9-11-13-18/h9-13,15,19-23H,6-8,14,16H2,1-5H3,(H,24,26)/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | VGXCHRYWHCHJES-ZQGJOIPISA-N |
| XLogP | 3.43 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|