C28H54O5Si2 — CID 101169063
methyl (1S,2S,3R,3aR,4R,5R,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2-methyl-1-tri(propan-2-yl)silyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate (PubChem CID 101169063) has the molecular formula C28H54O5Si2 and a molecular weight of 526.91 g/mol. Its IUPAC name is methyl (1S,2S,3R,3aR,4R,5R,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2-methyl-1-tri(propan-2-yl)silyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (1S,2S,3R,3aR,4R,5R,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2-methyl-1-tri(propan-2-yl)silyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 101169063 |
| Molecular Formula | C28H54O5Si2 |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | methyl (1S,2S,3R,3aR,4R,5R,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2-methyl-1-tri(propan-2-yl)silyloxy-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2[C@@H](O)[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]2C=C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O5Si2/c1-17(2)35(18(3)4,19(5)6)33-26-20(7)25(29)24-22(26)15-14-21(23(24)27(30)31-11)16-32-34(12,13)28(8,9)10/h14-15,17-26,29H,16H2,1-13H3/t20-,21-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | IYCNADIHTZFVOU-NVDMUHRWSA-N |
| XLogP | 6.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|