C31H56O7Si2 — CID 25053609
methyl (1R,2R,4S,5S,7S,8S,9R,10R)-10-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethenyl-9-tri(propan-2-yl)silyloxy-6-oxatricyclo[5.3.0.02,5]decane-4-carboxylate (PubChem CID 25053609) has the molecular formula C31H56O7Si2 and a molecular weight of 596.95 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S,7S,8S,9R,10R)-10-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethenyl-9-tri(propan-2-yl)silyloxy-6-oxatricyclo[5.3.0.02,5]decane-4-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S,7S,8S,9R,10R)-10-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethenyl-9-tri(propan-2-yl)silyloxy-6-oxatricyclo[5.3.0.02,5]decane-4-carboxylate |
|---|---|
| PubChem CID | 25053609 |
| Molecular Formula | C31H56O7Si2 |
| Molecular Weight | 596.95 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | methyl (1R,2R,4S,5S,7S,8S,9R,10R)-10-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethenyl-9-tri(propan-2-yl)silyloxy-6-oxatricyclo[5.3.0.02,5]decane-4-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](OC(C)=O)[C@H]2[C@@H]1O[C@]1(CO[Si](C)(C)C(C)(C)C)[C@@H](C(=O)OC)C[C@H]21 |
| InChI | InChI=1S/C31H56O7Si2/c1-15-22-26-25(28(36-21(8)32)27(22)38-40(18(2)3,19(4)5)20(6)7)23-16-24(29(33)34-12)31(23,37-26)17-35-39(13,14)30(9,10)11/h15,18-20,22-28H,1,16-17H2,2-14H3/t22-,23+,24+,25+,26+,27+,28+,31-/m0/s1 |
| InChIKey | VSDGTGILIKWAER-AHCSYBJOSA-N |
| XLogP | 6.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.95 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|