C20H34O6Si — CID 11069371
dimethyl (1S,2R,3S,4R)-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 11069371) has the molecular formula C20H34O6Si and a molecular weight of 398.57 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,4R)-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,4R)-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11069371 |
| Molecular Formula | C20H34O6Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | dimethyl (1S,2R,3S,4R)-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C(=O)OC)[C@]2(CO[Si](C(C)C)(C(C)C)C(C)C)C=C[C@H]1O2 |
| InChI | InChI=1S/C20H34O6Si/c1-12(2)27(13(3)4,14(5)6)25-11-20-10-9-15(26-20)16(18(21)23-7)17(20)19(22)24-8/h9-10,12-17H,11H2,1-8H3/t15-,16-,17+,20-/m1/s1 |
| InChIKey | WQLZRIUCFJGUPN-PDOICOKGSA-N |
| XLogP | 3.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|