C9H11NO5 — CID 100930853
methyl (1R,2S,3S,4S)-4-methyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 100930853) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is methyl (1R,2S,3S,4S)-4-methyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,4S)-4-methyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 100930853 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | methyl (1R,2S,3S,4S)-4-methyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]([N+](=O)[O-])[C@]2(C)C=C[C@H]1O2 |
| InChI | InChI=1S/C9H11NO5/c1-9-4-3-5(15-9)6(8(11)14-2)7(9)10(12)13/h3-7H,1-2H3/t5-,6-,7+,9+/m1/s1 |
| InChIKey | DUBWAWNXXFZSAU-JAKMQLQISA-N |
| XLogP | 0.15 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|