C17H20O6 — CID 124524681
dimethyl (1R,2R,3S,6S,7R,8R)-1,3,6-trimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-4,5-dicarboxylate (PubChem CID 124524681) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is dimethyl (1R,2R,3S,6S,7R,8R)-1,3,6-trimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-4,5-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3S,6S,7R,8R)-1,3,6-trimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 124524681 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | dimethyl (1R,2R,3S,6S,7R,8R)-1,3,6-trimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(C)O[C@@]1(C)[C@@H]1[C@@H]2[C@@]2(C)C=C[C@H]1O2 |
| InChI | InChI=1S/C17H20O6/c1-15-7-6-8(22-15)9-12(15)17(3)11(14(19)21-5)10(13(18)20-4)16(9,2)23-17/h6-9,12H,1-5H3/t8-,9+,12-,15-,16+,17-/m1/s1 |
| InChIKey | XWPHQVZRCZJWTC-GQJOSXDUSA-N |
| XLogP | 1.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|