C22H24O10 — CID 71658181
tetramethyl (1S,2R,3S,4R,7S,8S,9R,10R)-1,4-dimethyl-13,14-dioxapentacyclo[8.2.1.14,7.02,9.03,8]tetradeca-5,11-diene-5,6,11,12-tetracarboxylate (PubChem CID 71658181) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is tetramethyl (1S,2R,3S,4R,7S,8S,9R,10R)-1,4-dimethyl-13,14-dioxapentacyclo[8.2.1.14,7.02,9.03,8]tetradeca-5,11-diene-5,6,11,12-tetracarboxylate.
| Compound Name | tetramethyl (1S,2R,3S,4R,7S,8S,9R,10R)-1,4-dimethyl-13,14-dioxapentacyclo[8.2.1.14,7.02,9.03,8]tetradeca-5,11-diene-5,6,11,12-tetracarboxylate |
|---|---|
| PubChem CID | 71658181 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | tetramethyl (1S,2R,3S,4R,7S,8S,9R,10R)-1,4-dimethyl-13,14-dioxapentacyclo[8.2.1.14,7.02,9.03,8]tetradeca-5,11-diene-5,6,11,12-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(C)O[C@H]1[C@H]1[C@@H]3[C@H]([C@H]12)[C@]1(C)O[C@H]3C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C22H24O10/c1-21-11-7(15(31-21)9(17(23)27-3)13(21)19(25)29-5)8-12(11)22(2)14(20(26)30-6)10(16(8)32-22)18(24)28-4/h7-8,11-12,15-16H,1-6H3/t7-,8+,11-,12+,15-,16+,21+,22- |
| InChIKey | KVDHFQHMVBTUKV-WWYXYANZSA-N |
| XLogP | 0.09 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|