C21H18O4 — CID 623667
dimethyl 1-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate (PubChem CID 623667) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is dimethyl 1-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate.
| Compound Name | dimethyl 1-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 623667 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | dimethyl 1-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C)c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C21H18O4/c1-21-14-10-6-4-8-12(14)16(13-9-5-7-11-15(13)21)17(19(22)24-2)18(21)20(23)25-3/h4-11,16H,1-3H3 |
| InChIKey | VUPJQGOQUCLOOM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |