C24H23IO4 — CID 102062827
dimethyl 1-(1-iodo-2-methylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate (PubChem CID 102062827) has the molecular formula C24H23IO4 and a molecular weight of 502.35 g/mol. Its IUPAC name is dimethyl 1-(1-iodo-2-methylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate.
| Compound Name | dimethyl 1-(1-iodo-2-methylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 102062827 |
| Molecular Formula | C24H23IO4 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | dimethyl 1-(1-iodo-2-methylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15,16-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(C)(C)CI)c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C24H23IO4/c1-23(2,13-25)24-16-11-7-5-9-14(16)18(15-10-6-8-12-17(15)24)19(21(26)28-3)20(24)22(27)29-4/h5-12,18H,13H2,1-4H3 |
| InChIKey | RIHIPKBGSIBYHR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|