C29H25ClO3 — CID 11730171
methyl 16-carbonochloridoyl-1-(2-methyl-1-phenylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate (PubChem CID 11730171) has the molecular formula C29H25ClO3 and a molecular weight of 456.97 g/mol. Its IUPAC name is methyl 16-carbonochloridoyl-1-(2-methyl-1-phenylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate.
| Compound Name | methyl 16-carbonochloridoyl-1-(2-methyl-1-phenylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate |
|---|---|
| PubChem CID | 11730171 |
| Molecular Formula | C29H25ClO3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | methyl 16-carbonochloridoyl-1-(2-methyl-1-phenylpropan-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene-15-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)Cl)C2c3ccccc3C1(C(C)(C)Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C29H25ClO3/c1-28(2,17-18-11-5-4-6-12-18)29-21-15-9-7-13-19(21)23(20-14-8-10-16-22(20)29)24(26(30)31)25(29)27(32)33-3/h4-16,23H,17H2,1-3H3 |
| InChIKey | JFLBRLAAPXYXJK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|