C21H31NO5 — CID 53248336
methyl (1S,2S,3S,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]-1-pent-4-enyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 53248336) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is methyl (1S,2S,3S,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]-1-pent-4-enyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,3S,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]-1-pent-4-enyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 53248336 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | methyl (1S,2S,3S,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]-1-pent-4-enyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C=CCCC[C@@]12C=C[C@@H](O1)[C@@H](N(CC=C)C(=O)OC(C)(C)C)[C@@H]2C(=O)OC |
| InChI | InChI=1S/C21H31NO5/c1-7-9-10-12-21-13-11-15(26-21)17(16(21)18(23)25-6)22(14-8-2)19(24)27-20(3,4)5/h7-8,11,13,15-17H,1-2,9-10,12,14H2,3-6H3/t15-,16-,17-,21+/m1/s1 |
| InChIKey | PXEUWYQBSXRRGR-LHUKNYEISA-N |
| XLogP | 3.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|