C36H60N2O13 — CID 159341545
tert-butyl (3R)-3-[1-acetyloxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate;tert-butyl (3R)-3-[1-hydroxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate (PubChem CID 159341545) has the molecular formula C36H60N2O13 and a molecular weight of 728.88 g/mol. Its IUPAC name is tert-butyl (3R)-3-[1-acetyloxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate;tert-butyl (3R)-3-[1-hydroxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate.
| Compound Name | tert-butyl (3R)-3-[1-acetyloxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate;tert-butyl (3R)-3-[1-hydroxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate |
|---|---|
| PubChem CID | 159341545 |
| Molecular Formula | C36H60N2O13 |
| Molecular Weight | 728.88 g/mol |
| Exact Mass | 728.41 |
| IUPAC Name | tert-butyl (3R)-3-[1-acetyloxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate;tert-butyl (3R)-3-[1-hydroxy-2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]oct-7-enoate |
| SMILES | C=CCCCC(CC(=O)OC(C)(C)C)C(OC(C)=O)C(=O)NCC(=O)OC.C=CCCC[C@H](CC(=O)OC(C)(C)C)C(O)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C19H31NO7.C17H29NO6/c1-7-8-9-10-14(11-15(22)27-19(3,4)5)17(26-13(2)21)18(24)20-12-16(23)25-6;1-6-7-8-9-12(10-13(19)24-17(2,3)4)15(21)16(22)18-11-14(20)23-5/h7,14,17H,1,8-12H2,2-6H3,(H,20,24);6,12,15,21H,1,7-11H2,2-5H3,(H,18,22)/t;12-,15?/m.1/s1 |
| InChIKey | LGEXHFXQKXYRQD-RPLHXJLSSA-N |
| XLogP | 3.25 |
| TPSA | 209.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|