C19H29NO5 — CID 11291081
1-O-tert-butyl 2-O-methyl (2S)-4,4-bis(but-3-enyl)-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 11291081) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-4,4-bis(but-3-enyl)-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-4,4-bis(but-3-enyl)-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11291081 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-4,4-bis(but-3-enyl)-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCCC1(CCC=C)C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H29NO5/c1-7-9-11-19(12-10-8-2)13-14(15(21)24-6)20(16(19)22)17(23)25-18(3,4)5/h7-8,14H,1-2,9-13H2,3-6H3/t14-/m0/s1 |
| InChIKey | CUFCNGQGHOYCSR-AWEZNQCLSA-N |
| XLogP | 3.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|