C17H27NO5 — CID 15541767
ditert-butyl (2S,4R)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 15541767) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is ditert-butyl (2S,4R)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4R)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15541767 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | ditert-butyl (2S,4R)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@@H]1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C17H27NO5/c1-8-9-11-10-12(14(20)22-16(2,3)4)18(13(11)19)15(21)23-17(5,6)7/h8,11-12H,1,9-10H2,2-7H3/t11-,12+/m1/s1 |
| InChIKey | NTCJHQPBDPEAHW-NEPJUHHUSA-N |
| XLogP | 3.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|