C28H56O4Si2 — CID 11409672
(1R,2S,3S,3aS,6S,7R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,5-dimethyl-3-tri(propan-2-yl)silyloxy-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol (PubChem CID 11409672) has the molecular formula C28H56O4Si2 and a molecular weight of 512.92 g/mol. Its IUPAC name is (1R,2S,3S,3aS,6S,7R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,5-dimethyl-3-tri(propan-2-yl)silyloxy-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol.
| Compound Name | (1R,2S,3S,3aS,6S,7R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,5-dimethyl-3-tri(propan-2-yl)silyloxy-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 11409672 |
| Molecular Formula | C28H56O4Si2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | (1R,2S,3S,3aS,6S,7R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(hydroxymethyl)-2,5-dimethyl-3-tri(propan-2-yl)silyloxy-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol |
| SMILES | CC1=C[C@@H]2[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@H](O)[C@H]2[C@H](CO)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O4Si2/c1-17(2)34(18(3)4,19(5)6)32-27-21(8)26(30)25-22(27)14-20(7)24(23(25)15-29)16-31-33(12,13)28(9,10)11/h14,17-19,21-27,29-30H,15-16H2,1-13H3/t21-,22-,23+,24+,25+,26-,27+/m0/s1 |
| InChIKey | JVQSWADLDYRLIN-UOCBTZAVSA-N |
| XLogP | 7.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|