C30H50O3Si — CID 101463190
[(1R,2R,4aS,5R,8R,8aR)-3,8-dimethyl-2-(phenylmethoxymethyl)-5-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol (PubChem CID 101463190) has the molecular formula C30H50O3Si and a molecular weight of 486.81 g/mol. Its IUPAC name is [(1R,2R,4aS,5R,8R,8aR)-3,8-dimethyl-2-(phenylmethoxymethyl)-5-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol.
| Compound Name | [(1R,2R,4aS,5R,8R,8aR)-3,8-dimethyl-2-(phenylmethoxymethyl)-5-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 101463190 |
| Molecular Formula | C30H50O3Si |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | [(1R,2R,4aS,5R,8R,8aR)-3,8-dimethyl-2-(phenylmethoxymethyl)-5-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol |
| SMILES | CC1=C[C@@H]2[C@@H]([C@@H](CO)[C@H]1COCc1ccccc1)[C@H](C)CC[C@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H50O3Si/c1-20(2)34(21(3)4,22(5)6)33-29-15-14-23(7)30-26(29)16-24(8)28(27(30)17-31)19-32-18-25-12-10-9-11-13-25/h9-13,16,20-23,26-31H,14-15,17-19H2,1-8H3/t23-,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | LQMWGORBEHFPLL-HPZRALQFSA-N |
| XLogP | 7.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|