C46H52O4P2 — CID 59371896
(2S,5S)-1-[2-[(2S,5S)-2,5-bis(phenylmethoxymethyl)phospholan-1-yl]phenyl]-2,5-bis(phenylmethoxymethyl)phospholane (PubChem CID 59371896) has the molecular formula C46H52O4P2 and a molecular weight of 730.87 g/mol. Its IUPAC name is (2S,5S)-1-[2-[(2S,5S)-2,5-bis(phenylmethoxymethyl)phospholan-1-yl]phenyl]-2,5-bis(phenylmethoxymethyl)phospholane.
| Compound Name | (2S,5S)-1-[2-[(2S,5S)-2,5-bis(phenylmethoxymethyl)phospholan-1-yl]phenyl]-2,5-bis(phenylmethoxymethyl)phospholane |
|---|---|
| PubChem CID | 59371896 |
| Molecular Formula | C46H52O4P2 |
| Molecular Weight | 730.87 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | (2S,5S)-1-[2-[(2S,5S)-2,5-bis(phenylmethoxymethyl)phospholan-1-yl]phenyl]-2,5-bis(phenylmethoxymethyl)phospholane |
| SMILES | c1ccc(COC[C@@H]2CC[C@@H](COCc3ccccc3)P2c2ccccc2P2[C@H](COCc3ccccc3)CC[C@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C46H52O4P2/c1-5-15-37(16-6-1)29-47-33-41-25-26-42(34-48-30-38-17-7-2-8-18-38)51(41)45-23-13-14-24-46(45)52-43(35-49-31-39-19-9-3-10-20-39)27-28-44(52)36-50-32-40-21-11-4-12-22-40/h1-24,41-44H,25-36H2/t41-,42-,43-,44-/m0/s1 |
| InChIKey | MHTOWDUMJZFYTI-ITMZJIMRSA-N |
| XLogP | 9.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.87 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|