C31H58O5Si2 — CID 139261347
(4R,5R,6R)-5-phenylmethoxy-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-2-ol (PubChem CID 139261347) has the molecular formula C31H58O5Si2 and a molecular weight of 566.97 g/mol. Its IUPAC name is (4R,5R,6R)-5-phenylmethoxy-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-2-ol.
| Compound Name | (4R,5R,6R)-5-phenylmethoxy-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-2-ol |
|---|---|
| PubChem CID | 139261347 |
| Molecular Formula | C31H58O5Si2 |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | (4R,5R,6R)-5-phenylmethoxy-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-2-ol |
| SMILES | CC(C)[Si](OC[C@H]1OC(O)C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H58O5Si2/c1-21(2)37(22(3)4,23(5)6)34-20-29-31(33-19-27-16-14-13-15-17-27)28(18-30(32)35-29)36-38(24(7)8,25(9)10)26(11)12/h13-17,21-26,28-32H,18-20H2,1-12H3/t28-,29-,30?,31+/m1/s1 |
| InChIKey | NLTUCMLRLWNLNS-MNPNTUJWSA-N |
| XLogP | 8.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|