C42H60O7Si — CID 10930539
(2R,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enoxy]oxan-3-ol (PubChem CID 10930539) has the molecular formula C42H60O7Si and a molecular weight of 705.02 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enoxy]oxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enoxy]oxan-3-ol |
|---|---|
| PubChem CID | 10930539 |
| Molecular Formula | C42H60O7Si |
| Molecular Weight | 705.02 g/mol |
| Exact Mass | 704.41 |
| IUPAC Name | (2R,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enoxy]oxan-3-ol |
| SMILES | CC/C=C(\CO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H60O7Si/c1-8-18-37(29-48-50(31(2)3,32(4)5)33(6)7)28-47-42-39(43)41(46-27-36-23-16-11-17-24-36)40(45-26-35-21-14-10-15-22-35)38(49-42)30-44-25-34-19-12-9-13-20-34/h9-24,31-33,38-43H,8,25-30H2,1-7H3/b37-18+/t38-,39-,40-,41-,42-/m1/s1 |
| InChIKey | UUPJIAMWPDHRSF-RKZOKWQZSA-N |
| XLogP | 9.00 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.02 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|